C19H34O6 — CID 87100214
2,3-di(propanoyloxy)propyl decanoate (PubChem CID 87100214) has the molecular formula C19H34O6 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2,3-di(propanoyloxy)propyl decanoate.
| Compound Name | 2,3-di(propanoyloxy)propyl decanoate |
|---|---|
| PubChem CID | 87100214 |
| Molecular Formula | C19H34O6 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 2,3-di(propanoyloxy)propyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(COC(=O)CC)OC(=O)CC |
| InChI | InChI=1S/C19H34O6/c1-4-7-8-9-10-11-12-13-19(22)24-15-16(25-18(21)6-3)14-23-17(20)5-2/h16H,4-15H2,1-3H3 |
| InChIKey | BNXQJOCAMLWRMS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|