About [(2R)-1-oxopropan-2-yl] butanoate
[(2R)-1-oxopropan-2-yl] butanoate (PubChem CID 124506646) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is [(2R)-1-oxopropan-2-yl] butanoate.
Molecular Properties
| Compound Name | [(2R)-1-oxopropan-2-yl] butanoate |
| PubChem CID | 124506646 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | [(2R)-1-oxopropan-2-yl] butanoate |
| SMILES | CCCC(=O)O[C@H](C)C=O |
| InChI | InChI=1S/C7H12O3/c1-3-4-7(9)10-6(2)5-8/h5-6H,3-4H2,1-2H3/t6-/m1/s1 |
| InChIKey | JXOVRINZELLEBR-ZCFIWIBFSA-N |
| XLogP | 0.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-oxopropan-2-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-oxopropan-2-yl] butanoate?
The IUPAC name of [(2R)-1-oxopropan-2-yl] butanoate (CID 124506646) is [(2R)-1-oxopropan-2-yl] butanoate.
What is the SMILES notation for [(2R)-1-oxopropan-2-yl] butanoate?
The canonical SMILES for [(2R)-1-oxopropan-2-yl] butanoate is CCCC(=O)O[C@H](C)C=O.
What is the InChIKey of [(2R)-1-oxopropan-2-yl] butanoate?
The InChIKey is JXOVRINZELLEBR-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-4-7(9)10-6(2)5-8/h5-6H,3-4H2,1-2H3/t6-/m1/s1.
What are the key properties of [(2R)-1-oxopropan-2-yl] butanoate?
[(2R)-1-oxopropan-2-yl] butanoate has a molecular weight of 144.17 g/mol, XLogP of 0.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-oxopropan-2-yl] butanoate is sourced from PubChem (CID 124506646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).