About 1-formyloxyethyl butanoate
1-formyloxyethyl butanoate (PubChem CID 54235883) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is 1-formyloxyethyl butanoate.
Molecular Properties
| Compound Name | 1-formyloxyethyl butanoate |
| PubChem CID | 54235883 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1-formyloxyethyl butanoate |
| SMILES | CCCC(=O)OC(C)OC=O |
| InChI | InChI=1S/C7H12O4/c1-3-4-7(9)11-6(2)10-5-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | WQAZQWCYXFOZMZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-formyloxyethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-formyloxyethyl butanoate?
The IUPAC name of 1-formyloxyethyl butanoate (CID 54235883) is 1-formyloxyethyl butanoate.
What is the SMILES notation for 1-formyloxyethyl butanoate?
The canonical SMILES for 1-formyloxyethyl butanoate is CCCC(=O)OC(C)OC=O.
What is the InChIKey of 1-formyloxyethyl butanoate?
The InChIKey is WQAZQWCYXFOZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-3-4-7(9)11-6(2)10-5-8/h5-6H,3-4H2,1-2H3.
What are the key properties of 1-formyloxyethyl butanoate?
1-formyloxyethyl butanoate has a molecular weight of 160.17 g/mol, XLogP of 0.85, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-formyloxyethyl butanoate is sourced from PubChem (CID 54235883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).