About 1-(dipropylamino)ethyl butanoate
1-(dipropylamino)ethyl butanoate (PubChem CID 21484662) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-(dipropylamino)ethyl butanoate.
Molecular Properties
| Compound Name | 1-(dipropylamino)ethyl butanoate |
| PubChem CID | 21484662 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 1-(dipropylamino)ethyl butanoate |
| SMILES | CCCC(=O)OC(C)N(CCC)CCC |
| InChI | InChI=1S/C12H25NO2/c1-5-8-12(14)15-11(4)13(9-6-2)10-7-3/h11H,5-10H2,1-4H3 |
| InChIKey | QAVPLHGHSPHIHE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dipropylamino)ethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dipropylamino)ethyl butanoate?
The IUPAC name of 1-(dipropylamino)ethyl butanoate (CID 21484662) is 1-(dipropylamino)ethyl butanoate.
What is the SMILES notation for 1-(dipropylamino)ethyl butanoate?
The canonical SMILES for 1-(dipropylamino)ethyl butanoate is CCCC(=O)OC(C)N(CCC)CCC.
What is the InChIKey of 1-(dipropylamino)ethyl butanoate?
The InChIKey is QAVPLHGHSPHIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-5-8-12(14)15-11(4)13(9-6-2)10-7-3/h11H,5-10H2,1-4H3.
What are the key properties of 1-(dipropylamino)ethyl butanoate?
1-(dipropylamino)ethyl butanoate has a molecular weight of 215.34 g/mol, XLogP of 2.80, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dipropylamino)ethyl butanoate is sourced from PubChem (CID 21484662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).