C14H21BrO9 — CID 89322566
(3,4,5-triacetyloxy-6-bromo-6-hydroxyhexyl) acetate (PubChem CID 89322566) has the molecular formula C14H21BrO9 and a molecular weight of 413.22 g/mol. Its IUPAC name is (3,4,5-triacetyloxy-6-bromo-6-hydroxyhexyl) acetate.
| Compound Name | (3,4,5-triacetyloxy-6-bromo-6-hydroxyhexyl) acetate |
|---|---|
| PubChem CID | 89322566 |
| Molecular Formula | C14H21BrO9 |
| Molecular Weight | 413.22 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (3,4,5-triacetyloxy-6-bromo-6-hydroxyhexyl) acetate |
| SMILES | CC(=O)OCCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(O)Br |
| InChI | InChI=1S/C14H21BrO9/c1-7(16)21-6-5-11(22-8(2)17)12(23-9(3)18)13(14(15)20)24-10(4)19/h11-14,20H,5-6H2,1-4H3 |
| InChIKey | SSOSRMSRSXNXOZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|