C9H14Br2O5 — CID 11760214
[(2R,4S)-4-acetyloxy-1,5-dibromo-3-hydroxypentan-2-yl] acetate (PubChem CID 11760214) has the molecular formula C9H14Br2O5 and a molecular weight of 362.01 g/mol. Its IUPAC name is [(2R,4S)-4-acetyloxy-1,5-dibromo-3-hydroxypentan-2-yl] acetate.
| Compound Name | [(2R,4S)-4-acetyloxy-1,5-dibromo-3-hydroxypentan-2-yl] acetate |
|---|---|
| PubChem CID | 11760214 |
| Molecular Formula | C9H14Br2O5 |
| Molecular Weight | 362.01 g/mol |
| Exact Mass | 359.92 |
| IUPAC Name | [(2R,4S)-4-acetyloxy-1,5-dibromo-3-hydroxypentan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](CBr)C(O)[C@@H](CBr)OC(C)=O |
| InChI | InChI=1S/C9H14Br2O5/c1-5(12)15-7(3-10)9(14)8(4-11)16-6(2)13/h7-9,14H,3-4H2,1-2H3/t7-,8+,9? |
| InChIKey | RPPDXZWIEAMNMK-JVHMLUBASA-N |
| XLogP | 1.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.01 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|