C22H28O10S — CID 10814720
[(3R,4S,5S)-3,4,5,6-tetraacetyloxy-6-phenylsulfanylhexyl] acetate (PubChem CID 10814720) has the molecular formula C22H28O10S and a molecular weight of 484.52 g/mol. Its IUPAC name is [(3R,4S,5S)-3,4,5,6-tetraacetyloxy-6-phenylsulfanylhexyl] acetate.
| Compound Name | [(3R,4S,5S)-3,4,5,6-tetraacetyloxy-6-phenylsulfanylhexyl] acetate |
|---|---|
| PubChem CID | 10814720 |
| Molecular Formula | C22H28O10S |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [(3R,4S,5S)-3,4,5,6-tetraacetyloxy-6-phenylsulfanylhexyl] acetate |
| SMILES | CC(=O)OCC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)C(OC(C)=O)Sc1ccccc1 |
| InChI | InChI=1S/C22H28O10S/c1-13(23)28-12-11-19(29-14(2)24)20(30-15(3)25)21(31-16(4)26)22(32-17(5)27)33-18-9-7-6-8-10-18/h6-10,19-22H,11-12H2,1-5H3/t19-,20+,21+,22?/m1/s1 |
| InChIKey | MLHOFJGRHQFHFK-ZPHWTRHBSA-N |
| XLogP | 2.42 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|