C29H53NO7 — CID 102464376
[(Z,3R,4R,5S,6R,9S,10S,12S,13S)-4-acetyloxy-1-[formyl(methyl)amino]-14-hydroxy-10-methoxy-3,5,9,12,13-pentamethyltetradec-1-en-6-yl] 2-methylbutanoate (PubChem CID 102464376) has the molecular formula C29H53NO7 and a molecular weight of 527.74 g/mol. Its IUPAC name is [(Z,3R,4R,5S,6R,9S,10S,12S,13S)-4-acetyloxy-1-[formyl(methyl)amino]-14-hydroxy-10-methoxy-3,5,9,12,13-pentamethyltetradec-1-en-6-yl] 2-methylbutanoate.
| Compound Name | [(Z,3R,4R,5S,6R,9S,10S,12S,13S)-4-acetyloxy-1-[formyl(methyl)amino]-14-hydroxy-10-methoxy-3,5,9,12,13-pentamethyltetradec-1-en-6-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 102464376 |
| Molecular Formula | C29H53NO7 |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.38 |
| IUPAC Name | [(Z,3R,4R,5S,6R,9S,10S,12S,13S)-4-acetyloxy-1-[formyl(methyl)amino]-14-hydroxy-10-methoxy-3,5,9,12,13-pentamethyltetradec-1-en-6-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)O[C@H](CC[C@H](C)[C@H](C[C@H](C)[C@H](C)CO)OC)[C@H](C)[C@H](OC(C)=O)[C@H](C)/C=C\N(C)C=O |
| InChI | InChI=1S/C29H53NO7/c1-11-19(2)29(34)37-26(13-12-20(3)27(35-10)16-22(5)23(6)17-31)24(7)28(36-25(8)33)21(4)14-15-30(9)18-32/h14-15,18-24,26-28,31H,11-13,16-17H2,1-10H3/b15-14-/t19?,20-,21+,22-,23+,24-,26+,27-,28+/m0/s1 |
| InChIKey | OXAQVBUMOCAKCA-BKDKKDJUSA-N |
| XLogP | 4.84 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|