C29H53NO6 — CID 164972773
[(E,3R,4R,5S,6R,9S,10S,12R)-12-but-1-en-2-yloxy-1-[formyl(methyl)amino]-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] 2-methylpropanoate (PubChem CID 164972773) has the molecular formula C29H53NO6 and a molecular weight of 511.74 g/mol. Its IUPAC name is [(E,3R,4R,5S,6R,9S,10S,12R)-12-but-1-en-2-yloxy-1-[formyl(methyl)amino]-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] 2-methylpropanoate.
| Compound Name | [(E,3R,4R,5S,6R,9S,10S,12R)-12-but-1-en-2-yloxy-1-[formyl(methyl)amino]-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 164972773 |
| Molecular Formula | C29H53NO6 |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.39 |
| IUPAC Name | [(E,3R,4R,5S,6R,9S,10S,12R)-12-but-1-en-2-yloxy-1-[formyl(methyl)amino]-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] 2-methylpropanoate |
| SMILES | C=C(CC)O[C@H](CC)C[C@H](OC)[C@@H](C)CC[C@@H](OC(=O)C(C)C)[C@H](C)[C@H](OC)[C@H](C)/C=C/N(C)C=O |
| InChI | InChI=1S/C29H53NO6/c1-12-23(7)35-25(13-2)18-27(33-10)21(5)14-15-26(36-29(32)20(3)4)24(8)28(34-11)22(6)16-17-30(9)19-31/h16-17,19-22,24-28H,7,12-15,18H2,1-6,8-11H3/b17-16+/t21-,22+,24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | OEGZQKZEMIXVNT-ZNELIGFWSA-N |
| XLogP | 5.98 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|