C11H22O3 — CID 16751426
[(2S,4R)-4-hydroxy-5-methylhexan-2-yl] 2-methylpropanoate (PubChem CID 16751426) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is [(2S,4R)-4-hydroxy-5-methylhexan-2-yl] 2-methylpropanoate.
| Compound Name | [(2S,4R)-4-hydroxy-5-methylhexan-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 16751426 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | [(2S,4R)-4-hydroxy-5-methylhexan-2-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@@H](C)C[C@@H](O)C(C)C |
| InChI | InChI=1S/C11H22O3/c1-7(2)10(12)6-9(5)14-11(13)8(3)4/h7-10,12H,6H2,1-5H3/t9-,10+/m0/s1 |
| InChIKey | ZIPDSKCTKGLWMA-VHSXEESVSA-N |
| XLogP | 1.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |