C23H38INO6 — CID 155162305
[(E,3R,4R,5S,6R,9S,10S,12S)-9-amino-10,12-dihydroxy-1-iodo-4-methoxy-3,5,13-trimethyltetradec-1-en-6-yl] furan-2-carboxylate (PubChem CID 155162305) has the molecular formula C23H38INO6 and a molecular weight of 551.46 g/mol. Its IUPAC name is [(E,3R,4R,5S,6R,9S,10S,12S)-9-amino-10,12-dihydroxy-1-iodo-4-methoxy-3,5,13-trimethyltetradec-1-en-6-yl] furan-2-carboxylate.
| Compound Name | [(E,3R,4R,5S,6R,9S,10S,12S)-9-amino-10,12-dihydroxy-1-iodo-4-methoxy-3,5,13-trimethyltetradec-1-en-6-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 155162305 |
| Molecular Formula | C23H38INO6 |
| Molecular Weight | 551.46 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | [(E,3R,4R,5S,6R,9S,10S,12S)-9-amino-10,12-dihydroxy-1-iodo-4-methoxy-3,5,13-trimethyltetradec-1-en-6-yl] furan-2-carboxylate |
| SMILES | CO[C@@H](C(C)[C@@H](CC[C@H](N)[C@@H](O)C[C@H](O)C(C)C)OC(=O)c1ccco1)[C@H](C)/C=C/I |
| InChI | InChI=1S/C23H38INO6/c1-14(2)18(26)13-19(27)17(25)8-9-20(31-23(28)21-7-6-12-30-21)16(4)22(29-5)15(3)10-11-24/h6-7,10-12,14-20,22,26-27H,8-9,13,25H2,1-5H3/b11-10+/t15-,16?,17+,18+,19+,20-,22-/m1/s1 |
| InChIKey | JKGBMELHJFPHIE-MLBUUFGHSA-N |
| XLogP | 3.92 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|