C30H64O5Si2 — CID 58822510
[3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-2,4,6,8-tetramethyldecyl] propanoate (PubChem CID 58822510) has the molecular formula C30H64O5Si2 and a molecular weight of 561.01 g/mol. Its IUPAC name is [3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-2,4,6,8-tetramethyldecyl] propanoate.
| Compound Name | [3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-2,4,6,8-tetramethyldecyl] propanoate |
|---|---|
| PubChem CID | 58822510 |
| Molecular Formula | C30H64O5Si2 |
| Molecular Weight | 561.01 g/mol |
| Exact Mass | 560.43 |
| IUPAC Name | [3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methoxy-2,4,6,8-tetramethyldecyl] propanoate |
| SMILES | CCC(=O)OCC(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(C)OC |
| InChI | InChI=1S/C30H64O5Si2/c1-18-26(31)33-20-23(4)27(34-36(14,15)29(7,8)9)21(2)19-22(3)28(24(5)25(6)32-13)35-37(16,17)30(10,11)12/h21-25,27-28H,18-20H2,1-17H3 |
| InChIKey | QQTIQZQQHPWEFM-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.01 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|