C12H24O5Si — CID 102115680
dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxybutanedioate (PubChem CID 102115680) has the molecular formula C12H24O5Si and a molecular weight of 276.40 g/mol. Its IUPAC name is dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxybutanedioate.
| Compound Name | dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxybutanedioate |
|---|---|
| PubChem CID | 102115680 |
| Molecular Formula | C12H24O5Si |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxybutanedioate |
| SMILES | COC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C12H24O5Si/c1-12(2,3)18(6,7)17-9(11(14)16-5)8-10(13)15-4/h9H,8H2,1-7H3/t9-/m1/s1 |
| InChIKey | RLYXIPXHJVMOOL-SECBINFHSA-N |
| XLogP | 2.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|