C17H35NO5Si — CID 170984798
methyl 2-[tert-butyl(dimethyl)silyl]oxy-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoate (PubChem CID 170984798) has the molecular formula C17H35NO5Si and a molecular weight of 361.56 g/mol. Its IUPAC name is methyl 2-[tert-butyl(dimethyl)silyl]oxy-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoate.
| Compound Name | methyl 2-[tert-butyl(dimethyl)silyl]oxy-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoate |
|---|---|
| PubChem CID | 170984798 |
| Molecular Formula | C17H35NO5Si |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | methyl 2-[tert-butyl(dimethyl)silyl]oxy-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butanoate |
| SMILES | COC(=O)C(CCNCC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H35NO5Si/c1-16(2,3)22-14(19)12-18-11-10-13(15(20)21-7)23-24(8,9)17(4,5)6/h13,18H,10-12H2,1-9H3 |
| InChIKey | QUXFIKBGLKBCEK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|