C28H53N3O8 — CID 171651010
ditert-butyl (2S)-2-[bis[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]butanedioate (PubChem CID 171651010) has the molecular formula C28H53N3O8 and a molecular weight of 559.75 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[bis[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]butanedioate.
| Compound Name | ditert-butyl (2S)-2-[bis[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]butanedioate |
|---|---|
| PubChem CID | 171651010 |
| Molecular Formula | C28H53N3O8 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.38 |
| IUPAC Name | ditert-butyl (2S)-2-[bis[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]butanedioate |
| SMILES | CC(C)(C)OC(=O)CNCCN(CCNCC(=O)OC(C)(C)C)[C@@H](CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H53N3O8/c1-25(2,3)36-21(32)17-20(24(35)39-28(10,11)12)31(15-13-29-18-22(33)37-26(4,5)6)16-14-30-19-23(34)38-27(7,8)9/h20,29-30H,13-19H2,1-12H3/t20-/m0/s1 |
| InChIKey | KIIRGCUDRLVMBF-FQEVSTJZSA-N |
| XLogP | 2.59 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|