C13H28O4Si — CID 59279534
methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-propan-2-yloxypropanoate (PubChem CID 59279534) has the molecular formula C13H28O4Si and a molecular weight of 276.45 g/mol. Its IUPAC name is methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-propan-2-yloxypropanoate.
| Compound Name | methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-propan-2-yloxypropanoate |
|---|---|
| PubChem CID | 59279534 |
| Molecular Formula | C13H28O4Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-propan-2-yloxypropanoate |
| SMILES | COC(=O)[C@H](COC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O4Si/c1-10(2)16-9-11(12(14)15-6)17-18(7,8)13(3,4)5/h10-11H,9H2,1-8H3/t11-/m0/s1 |
| InChIKey | OZVFKESIBRCKGH-NSHDSACASA-N |
| XLogP | 2.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|