C28H58O5Si2 — CID 23253285
methyl (2R,3S,4S,6S,10S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,10-tetramethyl-7-oxoundecanoate (PubChem CID 23253285) has the molecular formula C28H58O5Si2 and a molecular weight of 530.94 g/mol. Its IUPAC name is methyl (2R,3S,4S,6S,10S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,10-tetramethyl-7-oxoundecanoate.
| Compound Name | methyl (2R,3S,4S,6S,10S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,10-tetramethyl-7-oxoundecanoate |
|---|---|
| PubChem CID | 23253285 |
| Molecular Formula | C28H58O5Si2 |
| Molecular Weight | 530.94 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | methyl (2R,3S,4S,6S,10S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,10-tetramethyl-7-oxoundecanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@H](C)C(=O)CC[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H58O5Si2/c1-20(19-32-34(12,13)27(5,6)7)16-17-24(29)21(2)18-22(3)25(23(4)26(30)31-11)33-35(14,15)28(8,9)10/h20-23,25H,16-19H2,1-15H3/t20-,21-,22-,23+,25-/m0/s1 |
| InChIKey | DDBYNCQPEBTTSJ-WHGMEAMLSA-N |
| XLogP | 7.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.94 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|