C22H43ClO5Si — CID 140891098
methyl (2R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-10-chloro-6-(1,3-dioxolan-2-yl)-2,4-dimethyldecanoate (PubChem CID 140891098) has the molecular formula C22H43ClO5Si and a molecular weight of 451.12 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-10-chloro-6-(1,3-dioxolan-2-yl)-2,4-dimethyldecanoate.
| Compound Name | methyl (2R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-10-chloro-6-(1,3-dioxolan-2-yl)-2,4-dimethyldecanoate |
|---|---|
| PubChem CID | 140891098 |
| Molecular Formula | C22H43ClO5Si |
| Molecular Weight | 451.12 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | methyl (2R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-10-chloro-6-(1,3-dioxolan-2-yl)-2,4-dimethyldecanoate |
| SMILES | COC(=O)[C@H](C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCCCCl)C1OCCO1 |
| InChI | InChI=1S/C22H43ClO5Si/c1-16(15-17(2)20(24)25-6)19(28-29(7,8)22(3,4)5)18(11-9-10-12-23)21-26-13-14-27-21/h16-19,21H,9-15H2,1-8H3/t16-,17+,18+,19+/m0/s1 |
| InChIKey | VMPQMZCJPBPXFL-WJFTUGDTSA-N |
| XLogP | 5.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.12 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|