C27H52O6Si — CID 23253343
methyl (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2,4,6-trimethyl-7-oxononanoate (PubChem CID 23253343) has the molecular formula C27H52O6Si and a molecular weight of 500.79 g/mol. Its IUPAC name is methyl (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2,4,6-trimethyl-7-oxononanoate.
| Compound Name | methyl (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2,4,6-trimethyl-7-oxononanoate |
|---|---|
| PubChem CID | 23253343 |
| Molecular Formula | C27H52O6Si |
| Molecular Weight | 500.79 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | methyl (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2,4,6-trimethyl-7-oxononanoate |
| SMILES | CC[C@H]1OC(C)(C)O[C@@]1(C)CCC(=O)[C@H](C)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C27H52O6Si/c1-14-22-27(10,33-26(8,9)31-22)16-15-21(28)18(2)17-19(3)23(20(4)24(29)30-11)32-34(12,13)25(5,6)7/h18-20,22-23H,14-17H2,1-13H3/t18-,19+,20-,22-,23+,27+/m1/s1 |
| InChIKey | AWUXMYFDKNCNEX-FPBIHEHWSA-N |
| XLogP | 6.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.79 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|