C20H40O5Si — CID 134846360
(1S,2S,4S)-1-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-1-hydroxy-2,5,5-trimethyl-4-trimethylsilyloxyhexan-3-one (PubChem CID 134846360) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is (1S,2S,4S)-1-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-1-hydroxy-2,5,5-trimethyl-4-trimethylsilyloxyhexan-3-one.
| Compound Name | (1S,2S,4S)-1-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-1-hydroxy-2,5,5-trimethyl-4-trimethylsilyloxyhexan-3-one |
|---|---|
| PubChem CID | 134846360 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (1S,2S,4S)-1-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-1-hydroxy-2,5,5-trimethyl-4-trimethylsilyloxyhexan-3-one |
| SMILES | CC[C@H]1OC(C)(C)O[C@@]1(C)[C@@H](O)[C@H](C)C(=O)[C@@H](O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H40O5Si/c1-12-14-20(8,25-19(6,7)23-14)16(22)13(2)15(21)17(18(3,4)5)24-26(9,10)11/h13-14,16-17,22H,12H2,1-11H3/t13-,14-,16+,17-,20-/m1/s1 |
| InChIKey | LKZIHSRBRUWSHQ-GOSKSRJBSA-N |
| XLogP | 4.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|