C15H28O3S — CID 11108989
S-tert-butyl 4-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butanethioate (PubChem CID 11108989) has the molecular formula C15H28O3S and a molecular weight of 288.45 g/mol. Its IUPAC name is S-tert-butyl 4-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butanethioate.
| Compound Name | S-tert-butyl 4-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butanethioate |
|---|---|
| PubChem CID | 11108989 |
| Molecular Formula | C15H28O3S |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | S-tert-butyl 4-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butanethioate |
| SMILES | CC1(C)O[C@@H](CCCC(=O)SC(C)(C)C)C(C)(C)O1 |
| InChI | InChI=1S/C15H28O3S/c1-13(2,3)19-12(16)10-8-9-11-14(4,5)18-15(6,7)17-11/h11H,8-10H2,1-7H3/t11-/m0/s1 |
| InChIKey | XNESUQUXRFHYBE-NSHDSACASA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|