C33H60O4 — CID 176736394
2,2,4,4-tetramethyl-5-[(E)-6,6,11-trimethyl-3-methylidene-9-[2-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)ethyl]tridec-8-enyl]-1,3-dioxolane (PubChem CID 176736394) has the molecular formula C33H60O4 and a molecular weight of 520.84 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-5-[(E)-6,6,11-trimethyl-3-methylidene-9-[2-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)ethyl]tridec-8-enyl]-1,3-dioxolane.
| Compound Name | 2,2,4,4-tetramethyl-5-[(E)-6,6,11-trimethyl-3-methylidene-9-[2-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)ethyl]tridec-8-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 176736394 |
| Molecular Formula | C33H60O4 |
| Molecular Weight | 520.84 g/mol |
| Exact Mass | 520.45 |
| IUPAC Name | 2,2,4,4-tetramethyl-5-[(E)-6,6,11-trimethyl-3-methylidene-9-[2-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)ethyl]tridec-8-enyl]-1,3-dioxolane |
| SMILES | C=C(CCC1OC(C)(C)OC1(C)C)CCC(C)(C)C/C=C(\CCC1OC(C)(C)OC1(C)C)CC(C)CC |
| InChI | InChI=1S/C33H60O4/c1-14-24(2)23-26(16-18-28-31(8,9)37-33(12,13)35-28)20-22-29(4,5)21-19-25(3)15-17-27-30(6,7)36-32(10,11)34-27/h20,24,27-28H,3,14-19,21-23H2,1-2,4-13H3/b26-20+ |
| InChIKey | FAQCORKEDXONFX-LHLOQNFPSA-N |
| XLogP | 9.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.84 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|