C24H42O5S — CID 11719184
methyl (2R,4E,8E)-2,5,9-trimethyl-2-(methylsulfanylmethoxy)-11-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)undeca-4,8-dienoate (PubChem CID 11719184) has the molecular formula C24H42O5S and a molecular weight of 442.66 g/mol. Its IUPAC name is methyl (2R,4E,8E)-2,5,9-trimethyl-2-(methylsulfanylmethoxy)-11-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)undeca-4,8-dienoate.
| Compound Name | methyl (2R,4E,8E)-2,5,9-trimethyl-2-(methylsulfanylmethoxy)-11-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)undeca-4,8-dienoate |
|---|---|
| PubChem CID | 11719184 |
| Molecular Formula | C24H42O5S |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | methyl (2R,4E,8E)-2,5,9-trimethyl-2-(methylsulfanylmethoxy)-11-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)undeca-4,8-dienoate |
| SMILES | COC(=O)[C@@](C)(C/C=C(\C)CC/C=C(\C)CCC1OC(C)(C)OC1(C)C)OCSC |
| InChI | InChI=1S/C24H42O5S/c1-18(13-14-20-22(3,4)29-23(5,6)28-20)11-10-12-19(2)15-16-24(7,21(25)26-8)27-17-30-9/h11,15,20H,10,12-14,16-17H2,1-9H3/b18-11+,19-15+/t20?,24-/m1/s1 |
| InChIKey | HJUKAHHTINXGLM-ICNQMIJOSA-N |
| XLogP | 6.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|