C19H32O5 — CID 102127025
methyl (E,4S)-5-[(4S,5R)-5-[(2S,3R)-2-hydroxy-3-methylpent-4-enyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-4-methylpent-2-enoate (PubChem CID 102127025) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is methyl (E,4S)-5-[(4S,5R)-5-[(2S,3R)-2-hydroxy-3-methylpent-4-enyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-4-methylpent-2-enoate.
| Compound Name | methyl (E,4S)-5-[(4S,5R)-5-[(2S,3R)-2-hydroxy-3-methylpent-4-enyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 102127025 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | methyl (E,4S)-5-[(4S,5R)-5-[(2S,3R)-2-hydroxy-3-methylpent-4-enyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-4-methylpent-2-enoate |
| SMILES | C=C[C@@H](C)[C@@H](O)C[C@@]1(C)OC(C)(C)O[C@H]1C[C@H](C)/C=C/C(=O)OC |
| InChI | InChI=1S/C19H32O5/c1-8-14(3)15(20)12-19(6)16(23-18(4,5)24-19)11-13(2)9-10-17(21)22-7/h8-10,13-16,20H,1,11-12H2,2-7H3/b10-9+/t13-,14-,15+,16+,19-/m1/s1 |
| InChIKey | WWENVXNNLXTCHW-OGWSOGIFSA-N |
| XLogP | 3.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|