C21H32O7 — CID 11304020
methyl (E)-3-[(4S,5R)-5-[(2R,5R)-5-[(2S,5R)-5-[(1R)-1-hydroxybut-3-enyl]oxolan-2-yl]oxolan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 11304020) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is methyl (E)-3-[(4S,5R)-5-[(2R,5R)-5-[(2S,5R)-5-[(1R)-1-hydroxybut-3-enyl]oxolan-2-yl]oxolan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(4S,5R)-5-[(2R,5R)-5-[(2S,5R)-5-[(1R)-1-hydroxybut-3-enyl]oxolan-2-yl]oxolan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11304020 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | methyl (E)-3-[(4S,5R)-5-[(2R,5R)-5-[(2S,5R)-5-[(1R)-1-hydroxybut-3-enyl]oxolan-2-yl]oxolan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | C=CC[C@@H](O)[C@H]1CC[C@@H]([C@H]2CC[C@H]([C@H]3OC(C)(C)O[C@H]3/C=C/C(=O)OC)O2)O1 |
| InChI | InChI=1S/C21H32O7/c1-5-6-13(22)14-7-8-15(25-14)16-9-10-17(26-16)20-18(11-12-19(23)24-4)27-21(2,3)28-20/h5,11-18,20,22H,1,6-10H2,2-4H3/b12-11+/t13-,14-,15+,16-,17-,18+,20-/m1/s1 |
| InChIKey | QTPQUBHALVULKL-CEETVPGMSA-N |
| XLogP | 2.27 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|