C11H16O2 — CID 135074959
methyl (E)-3-(3-ethenyl-2,2-dimethylcyclopropyl)prop-2-enoate (PubChem CID 135074959) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is methyl (E)-3-(3-ethenyl-2,2-dimethylcyclopropyl)prop-2-enoate.
| Compound Name | methyl (E)-3-(3-ethenyl-2,2-dimethylcyclopropyl)prop-2-enoate |
|---|---|
| PubChem CID | 135074959 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | methyl (E)-3-(3-ethenyl-2,2-dimethylcyclopropyl)prop-2-enoate |
| SMILES | C=CC1C(/C=C/C(=O)OC)C1(C)C |
| InChI | InChI=1S/C11H16O2/c1-5-8-9(11(8,2)3)6-7-10(12)13-4/h5-9H,1H2,2-4H3/b7-6+ |
| InChIKey | BUPCNJJAOPAPMA-VOTSOKGWSA-N |
| XLogP | 2.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|