C13H12F2O2 — CID 134970714
methyl (E)-3-[(1R)-2,2-difluoro-3-phenylcyclopropyl]prop-2-enoate (PubChem CID 134970714) has the molecular formula C13H12F2O2 and a molecular weight of 238.23 g/mol. Its IUPAC name is methyl (E)-3-[(1R)-2,2-difluoro-3-phenylcyclopropyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1R)-2,2-difluoro-3-phenylcyclopropyl]prop-2-enoate |
|---|---|
| PubChem CID | 134970714 |
| Molecular Formula | C13H12F2O2 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | methyl (E)-3-[(1R)-2,2-difluoro-3-phenylcyclopropyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1C(c2ccccc2)C1(F)F |
| InChI | InChI=1S/C13H12F2O2/c1-17-11(16)8-7-10-12(13(10,14)15)9-5-3-2-4-6-9/h2-8,10,12H,1H3/b8-7+/t10-,12?/m1/s1 |
| InChIKey | ADTAFAOLORFVMV-OFSZZIBNSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|