C19H30O7 — CID 11111448
methyl (E)-3-[(1R,3S,8R,10R,12S,14R,15R)-15-hydroxy-6,6,10-trimethyl-2,5,7,13-tetraoxatricyclo[10.4.0.03,8]hexadecan-14-yl]prop-2-enoate (PubChem CID 11111448) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is methyl (E)-3-[(1R,3S,8R,10R,12S,14R,15R)-15-hydroxy-6,6,10-trimethyl-2,5,7,13-tetraoxatricyclo[10.4.0.03,8]hexadecan-14-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1R,3S,8R,10R,12S,14R,15R)-15-hydroxy-6,6,10-trimethyl-2,5,7,13-tetraoxatricyclo[10.4.0.03,8]hexadecan-14-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11111448 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | methyl (E)-3-[(1R,3S,8R,10R,12S,14R,15R)-15-hydroxy-6,6,10-trimethyl-2,5,7,13-tetraoxatricyclo[10.4.0.03,8]hexadecan-14-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@H]1O[C@H]2C[C@@H](C)C[C@H]3OC(C)(C)OC[C@@H]3O[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C19H30O7/c1-11-7-14-15(9-12(20)13(24-14)5-6-18(21)22-4)25-17-10-23-19(2,3)26-16(17)8-11/h5-6,11-17,20H,7-10H2,1-4H3/b6-5+/t11-,12-,13-,14+,15-,16-,17+/m1/s1 |
| InChIKey | BPYKPDJIZHARDP-YFOWOVKXSA-N |
| XLogP | 1.57 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|