C15H26O6 — CID 11162449
[(4aR,6S,7R,8aS)-6-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate (PubChem CID 11162449) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(4aR,6S,7R,8aS)-6-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [(4aR,6S,7R,8aS)-6-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11162449 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [(4aR,6S,7R,8aS)-6-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate |
| SMILES | CO[C@H]1O[C@@H]2COC(C)(C)O[C@H]2C[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H26O6/c1-14(2,3)13(16)20-10-7-9-11(19-12(10)17-6)8-18-15(4,5)21-9/h9-12H,7-8H2,1-6H3/t9-,10+,11+,12-/m0/s1 |
| InChIKey | MKZCBXMCWVOMET-QCNOEVLYSA-N |
| XLogP | 1.86 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |