C12H19NO6 — CID 12013745
1-O-ethyl 2-O-methyl (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-1,2-dicarboxylate (PubChem CID 12013745) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is 1-O-ethyl 2-O-methyl (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-1,2-dicarboxylate.
| Compound Name | 1-O-ethyl 2-O-methyl (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 12013745 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-O-ethyl 2-O-methyl (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)N1[C@@H]([C@H]2COC(C)(C)O2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C12H19NO6/c1-5-17-11(15)13-8(9(13)10(14)16-4)7-6-18-12(2,3)19-7/h7-9H,5-6H2,1-4H3/t7-,8+,9-,13?/m1/s1 |
| InChIKey | UANKVPJIUGALGU-HFJXHZNHSA-N |
| XLogP | 0.52 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|