C26H56O5Si3 — CID 10896760
(E,5R,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-5,7-dimethyl-6,8-bis(trimethylsilyloxy)undec-2-en-4-one (PubChem CID 10896760) has the molecular formula C26H56O5Si3 and a molecular weight of 532.99 g/mol. Its IUPAC name is (E,5R,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-5,7-dimethyl-6,8-bis(trimethylsilyloxy)undec-2-en-4-one.
| Compound Name | (E,5R,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-5,7-dimethyl-6,8-bis(trimethylsilyloxy)undec-2-en-4-one |
|---|---|
| PubChem CID | 10896760 |
| Molecular Formula | C26H56O5Si3 |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | (E,5R,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-5,7-dimethyl-6,8-bis(trimethylsilyloxy)undec-2-en-4-one |
| SMILES | C/C=C/C(=O)[C@H](C)[C@@H](O[Si](C)(C)C)[C@@H](C)[C@@H](C[C@H](COC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H56O5Si3/c1-16-17-23(27)20(2)25(31-33(11,12)13)21(3)24(30-32(8,9)10)18-22(19-28-7)29-34(14,15)26(4,5)6/h16-17,20-22,24-25H,18-19H2,1-15H3/b17-16+/t20-,21-,22+,24+,25+/m0/s1 |
| InChIKey | BCXFAHOIBCYCOZ-XBGYRBSESA-N |
| XLogP | 7.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|