C25H53NO4SSi2 — CID 11005830
S-(2-acetamidoethyl) (2R,3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylheptanethioate (PubChem CID 11005830) has the molecular formula C25H53NO4SSi2 and a molecular weight of 519.94 g/mol. Its IUPAC name is S-(2-acetamidoethyl) (2R,3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylheptanethioate.
| Compound Name | S-(2-acetamidoethyl) (2R,3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylheptanethioate |
|---|---|
| PubChem CID | 11005830 |
| Molecular Formula | C25H53NO4SSi2 |
| Molecular Weight | 519.94 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | S-(2-acetamidoethyl) (2R,3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylheptanethioate |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)SCCNC(C)=O |
| InChI | InChI=1S/C25H53NO4SSi2/c1-15-21(29-32(11,12)24(5,6)7)18(2)22(30-33(13,14)25(8,9)10)19(3)23(28)31-17-16-26-20(4)27/h18-19,21-22H,15-17H2,1-14H3,(H,26,27)/t18-,19+,21+,22-/m0/s1 |
| InChIKey | DRNGEBLKJNVZSZ-PSBKLILYSA-N |
| XLogP | 6.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.94 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|