C28H60O4Si2 — CID 11620544
(3S,4S,5S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7,9-tetramethyl-4-triethylsilyloxydodecan-6-one (PubChem CID 11620544) has the molecular formula C28H60O4Si2 and a molecular weight of 516.96 g/mol. Its IUPAC name is (3S,4S,5S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7,9-tetramethyl-4-triethylsilyloxydodecan-6-one.
| Compound Name | (3S,4S,5S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7,9-tetramethyl-4-triethylsilyloxydodecan-6-one |
|---|---|
| PubChem CID | 11620544 |
| Molecular Formula | C28H60O4Si2 |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.40 |
| IUPAC Name | (3S,4S,5S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7,9-tetramethyl-4-triethylsilyloxydodecan-6-one |
| SMILES | CC[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@H](C)C(=O)C(C)C(O)[C@@H](C)[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H60O4Si2/c1-15-20(6)27(32-34(17-3,18-4)19-5)23(9)26(30)22(8)25(29)21(7)24(16-2)31-33(13,14)28(10,11)12/h20-25,27,29H,15-19H2,1-14H3/t20-,21-,22?,23+,24+,25?,27-/m0/s1 |
| InChIKey | FHQKBSYWRYSJEF-RCNZKBFBSA-N |
| XLogP | 8.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|