C15H32O4Si — CID 135037790
(5S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxynonan-2-one (PubChem CID 135037790) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is (5S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxynonan-2-one.
| Compound Name | (5S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxynonan-2-one |
|---|---|
| PubChem CID | 135037790 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | (5S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxynonan-2-one |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)CCC(C)=O |
| InChI | InChI=1S/C15H32O4Si/c1-8-13(19-20(6,7)15(3,4)5)14(18)12(17)10-9-11(2)16/h12-14,17-18H,8-10H2,1-7H3/t12-,13+,14+/m0/s1 |
| InChIKey | HBVRNSOUCZBYPI-BFHYXJOUSA-N |
| XLogP | 2.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|