C35H68O7SSi — CID 11125198
[(E,3R,4R,5R,6R,9S,13R,15R)-5-[tert-butyl(dimethyl)silyl]oxy-9,15-dimethoxy-4,6,10,13-tetramethyl-3-(methylsulfanylmethoxy)-16-oxohexadec-10-enyl] 2,2-dimethylpropanoate (PubChem CID 11125198) has the molecular formula C35H68O7SSi and a molecular weight of 661.08 g/mol. Its IUPAC name is [(E,3R,4R,5R,6R,9S,13R,15R)-5-[tert-butyl(dimethyl)silyl]oxy-9,15-dimethoxy-4,6,10,13-tetramethyl-3-(methylsulfanylmethoxy)-16-oxohexadec-10-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,3R,4R,5R,6R,9S,13R,15R)-5-[tert-butyl(dimethyl)silyl]oxy-9,15-dimethoxy-4,6,10,13-tetramethyl-3-(methylsulfanylmethoxy)-16-oxohexadec-10-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11125198 |
| Molecular Formula | C35H68O7SSi |
| Molecular Weight | 661.08 g/mol |
| Exact Mass | 660.45 |
| IUPAC Name | [(E,3R,4R,5R,6R,9S,13R,15R)-5-[tert-butyl(dimethyl)silyl]oxy-9,15-dimethoxy-4,6,10,13-tetramethyl-3-(methylsulfanylmethoxy)-16-oxohexadec-10-enyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H](CC[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](CCOC(=O)C(C)(C)C)OCSC)/C(C)=C/C[C@@H](C)C[C@H](C=O)OC |
| InChI | InChI=1S/C35H68O7SSi/c1-25(22-29(23-36)38-11)16-17-26(2)30(39-12)19-18-27(3)32(42-44(14,15)35(8,9)10)28(4)31(41-24-43-13)20-21-40-33(37)34(5,6)7/h17,23,25,27-32H,16,18-22,24H2,1-15H3/b26-17+/t25-,27-,28-,29-,30+,31-,32-/m1/s1 |
| InChIKey | NJJRHWSKXFYVOG-PYJKVBBHSA-N |
| XLogP | 8.71 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.08 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|