C19H38O3Si — CID 54671878
(E,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,5,8,8-tetramethylnon-2-enoic acid (PubChem CID 54671878) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is (E,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,5,8,8-tetramethylnon-2-enoic acid.
| Compound Name | (E,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,5,8,8-tetramethylnon-2-enoic acid |
|---|---|
| PubChem CID | 54671878 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (E,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,5,8,8-tetramethylnon-2-enoic acid |
| SMILES | C/C(=C\C[C@H](C)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C19H38O3Si/c1-14(11-12-15(2)17(20)21)13-16(18(3,4)5)22-23(9,10)19(6,7)8/h12,14,16H,11,13H2,1-10H3,(H,20,21)/b15-12+/t14-,16-/m0/s1 |
| InChIKey | UJOFMJSVQMRXCS-NEWSFODOSA-N |
| XLogP | 5.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|