C13H29NO3Si — CID 167567951
[2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutyl] carbamate (PubChem CID 167567951) has the molecular formula C13H29NO3Si and a molecular weight of 275.46 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutyl] carbamate.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutyl] carbamate |
|---|---|
| PubChem CID | 167567951 |
| Molecular Formula | C13H29NO3Si |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutyl] carbamate |
| SMILES | CC(C)(C)C(COC(N)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H29NO3Si/c1-12(2,3)10(9-16-11(14)15)17-18(7,8)13(4,5)6/h10H,9H2,1-8H3,(H2,14,15) |
| InChIKey | FNJANEDEPIAPRC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|