About [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate
[(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate (PubChem CID 175027230) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate.
Molecular Properties
| Compound Name | [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate |
| PubChem CID | 175027230 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate |
| SMILES | CC(C)(C)[C@@H](O)COC(N)=O |
| InChI | InChI=1S/C7H15NO3/c1-7(2,3)5(9)4-11-6(8)10/h5,9H,4H2,1-3H3,(H2,8,10)/t5-/m0/s1 |
| InChIKey | MSNPGAXLSLZFAA-YFKPBYRVSA-N |
| XLogP | 0.49 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate?
The IUPAC name of [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate (CID 175027230) is [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate.
What is the SMILES notation for [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate?
The canonical SMILES for [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate is CC(C)(C)[C@@H](O)COC(N)=O.
What is the InChIKey of [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate?
The InChIKey is MSNPGAXLSLZFAA-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H15NO3/c1-7(2,3)5(9)4-11-6(8)10/h5,9H,4H2,1-3H3,(H2,8,10)/t5-/m0/s1.
What are the key properties of [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate?
[(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate has a molecular weight of 161.20 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-hydroxy-3,3-dimethylbutyl] carbamate is sourced from PubChem (CID 175027230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).