C6H14N2O3 — CID 87246058
[3-(dimethylamino)-2-hydroxypropyl] carbamate (PubChem CID 87246058) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is [3-(dimethylamino)-2-hydroxypropyl] carbamate.
| Compound Name | [3-(dimethylamino)-2-hydroxypropyl] carbamate |
|---|---|
| PubChem CID | 87246058 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | [3-(dimethylamino)-2-hydroxypropyl] carbamate |
| SMILES | CN(C)CC(O)COC(N)=O |
| InChI | InChI=1S/C6H14N2O3/c1-8(2)3-5(9)4-11-6(7)10/h5,9H,3-4H2,1-2H3,(H2,7,10) |
| InChIKey | QLMGLWYTBJBKRD-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |