C10H23N3O2 — CID 106096310
3-[[3-(dimethylamino)-2-hydroxypropyl]amino]-3-methylbutanamide (PubChem CID 106096310) has the molecular formula C10H23N3O2 and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-[[3-(dimethylamino)-2-hydroxypropyl]amino]-3-methylbutanamide.
| Compound Name | 3-[[3-(dimethylamino)-2-hydroxypropyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106096310 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3-[[3-(dimethylamino)-2-hydroxypropyl]amino]-3-methylbutanamide |
| SMILES | CN(C)CC(O)CNC(C)(C)CC(N)=O |
| InChI | InChI=1S/C10H23N3O2/c1-10(2,5-9(11)15)12-6-8(14)7-13(3)4/h8,12,14H,5-7H2,1-4H3,(H2,11,15) |
| InChIKey | XXSWBMGPPBFXJS-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |