C8H18N4O2 — CID 106097393
3-[(2,3-diamino-3-oxopropyl)amino]-3-methylbutanamide (PubChem CID 106097393) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-[(2,3-diamino-3-oxopropyl)amino]-3-methylbutanamide.
| Compound Name | 3-[(2,3-diamino-3-oxopropyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106097393 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3-[(2,3-diamino-3-oxopropyl)amino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)NCC(N)C(N)=O |
| InChI | InChI=1S/C8H18N4O2/c1-8(2,3-6(10)13)12-4-5(9)7(11)14/h5,12H,3-4,9H2,1-2H3,(H2,10,13)(H2,11,14) |
| InChIKey | JGDXMUPCNVIFAT-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |