C15H30N2O3 — CID 104580076
3-[[2-hydroxy-3-(3-methylcyclohexyl)oxypropyl]amino]-3-methylbutanamide (PubChem CID 104580076) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-[[2-hydroxy-3-(3-methylcyclohexyl)oxypropyl]amino]-3-methylbutanamide.
| Compound Name | 3-[[2-hydroxy-3-(3-methylcyclohexyl)oxypropyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 104580076 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 3-[[2-hydroxy-3-(3-methylcyclohexyl)oxypropyl]amino]-3-methylbutanamide |
| SMILES | CC1CCCC(OCC(O)CNC(C)(C)CC(N)=O)C1 |
| InChI | InChI=1S/C15H30N2O3/c1-11-5-4-6-13(7-11)20-10-12(18)9-17-15(2,3)8-14(16)19/h11-13,17-18H,4-10H2,1-3H3,(H2,16,19) |
| InChIKey | ZNTIORQRUSYHER-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |