C13H26N2O3 — CID 54938859
2-[[2-hydroxy-3-(3-methylcyclohexyl)oxypropyl]amino]propanamide (PubChem CID 54938859) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-[[2-hydroxy-3-(3-methylcyclohexyl)oxypropyl]amino]propanamide.
| Compound Name | 2-[[2-hydroxy-3-(3-methylcyclohexyl)oxypropyl]amino]propanamide |
|---|---|
| PubChem CID | 54938859 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 2-[[2-hydroxy-3-(3-methylcyclohexyl)oxypropyl]amino]propanamide |
| SMILES | CC1CCCC(OCC(O)CNC(C)C(N)=O)C1 |
| InChI | InChI=1S/C13H26N2O3/c1-9-4-3-5-12(6-9)18-8-11(16)7-15-10(2)13(14)17/h9-12,15-16H,3-8H2,1-2H3,(H2,14,17) |
| InChIKey | NJMFUPGWYJGDDL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |