C12H25NO2 — CID 102289117
(5S,7S)-7-hydroxy-5,8,8-trimethylnonanamide (PubChem CID 102289117) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is (5S,7S)-7-hydroxy-5,8,8-trimethylnonanamide.
| Compound Name | (5S,7S)-7-hydroxy-5,8,8-trimethylnonanamide |
|---|---|
| PubChem CID | 102289117 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | (5S,7S)-7-hydroxy-5,8,8-trimethylnonanamide |
| SMILES | C[C@@H](CCCC(N)=O)C[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C12H25NO2/c1-9(6-5-7-11(13)15)8-10(14)12(2,3)4/h9-10,14H,5-8H2,1-4H3,(H2,13,15)/t9-,10-/m0/s1 |
| InChIKey | BVWAQEKZUPVHIY-UWVGGRQHSA-N |
| XLogP | 2.08 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |