C21H40O4SSi — CID 164992495
(2E,5S,6S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-5-(methylsulfanylmethoxy)deca-2,8-dienoic acid (PubChem CID 164992495) has the molecular formula C21H40O4SSi and a molecular weight of 416.70 g/mol. Its IUPAC name is (2E,5S,6S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-5-(methylsulfanylmethoxy)deca-2,8-dienoic acid.
| Compound Name | (2E,5S,6S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-5-(methylsulfanylmethoxy)deca-2,8-dienoic acid |
|---|---|
| PubChem CID | 164992495 |
| Molecular Formula | C21H40O4SSi |
| Molecular Weight | 416.70 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (2E,5S,6S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-5-(methylsulfanylmethoxy)deca-2,8-dienoic acid |
| SMILES | C/C=C(\C)C(O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](C/C=C(\C)C(=O)O)OCSC |
| InChI | InChI=1S/C21H40O4SSi/c1-11-15(2)19(25-27(9,10)21(5,6)7)17(4)18(24-14-26-8)13-12-16(3)20(22)23/h11-12,17-19H,13-14H2,1-10H3,(H,22,23)/b15-11+,16-12+/t17-,18-,19?/m0/s1 |
| InChIKey | CGRKTLJKBJCVGL-PMOZFXLVSA-N |
| XLogP | 6.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.70 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|