C24H46O3Si — CID 11069627
methyl (2E,4E,6S,7S,10S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6,10,12-tetramethyltrideca-2,4-dienoate (PubChem CID 11069627) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is methyl (2E,4E,6S,7S,10S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6,10,12-tetramethyltrideca-2,4-dienoate.
| Compound Name | methyl (2E,4E,6S,7S,10S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6,10,12-tetramethyltrideca-2,4-dienoate |
|---|---|
| PubChem CID | 11069627 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | methyl (2E,4E,6S,7S,10S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6,10,12-tetramethyltrideca-2,4-dienoate |
| SMILES | COC(=O)/C=C/C(C)=C/[C@H](C)[C@H](CC[C@H](C)CC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O3Si/c1-18(2)16-19(3)12-14-22(27-28(10,11)24(6,7)8)21(5)17-20(4)13-15-23(25)26-9/h13,15,17-19,21-22H,12,14,16H2,1-11H3/b15-13+,20-17+/t19-,21-,22-/m0/s1 |
| InChIKey | ZBJJJYTWTRPMRC-DUUNVCBHSA-N |
| XLogP | 7.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|