C19H33BrO3Si — CID 71528231
methyl (2E,4E,6R,7R,8E)-9-bromo-7-[tert-butyl(dimethyl)silyl]oxy-4,6,8-trimethylnona-2,4,8-trienoate (PubChem CID 71528231) has the molecular formula C19H33BrO3Si and a molecular weight of 417.46 g/mol. Its IUPAC name is methyl (2E,4E,6R,7R,8E)-9-bromo-7-[tert-butyl(dimethyl)silyl]oxy-4,6,8-trimethylnona-2,4,8-trienoate.
| Compound Name | methyl (2E,4E,6R,7R,8E)-9-bromo-7-[tert-butyl(dimethyl)silyl]oxy-4,6,8-trimethylnona-2,4,8-trienoate |
|---|---|
| PubChem CID | 71528231 |
| Molecular Formula | C19H33BrO3Si |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | methyl (2E,4E,6R,7R,8E)-9-bromo-7-[tert-butyl(dimethyl)silyl]oxy-4,6,8-trimethylnona-2,4,8-trienoate |
| SMILES | COC(=O)/C=C/C(C)=C/[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/Br |
| InChI | InChI=1S/C19H33BrO3Si/c1-14(10-11-17(21)22-7)12-15(2)18(16(3)13-20)23-24(8,9)19(4,5)6/h10-13,15,18H,1-9H3/b11-10+,14-12+,16-13+/t15-,18-/m1/s1 |
| InChIKey | NUMICVYTNHRYJN-HBUJGULKSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|