C30H51NO3Si — CID 25034370
(2E,4E,6E,8E,10Z,12R,13R,14E)-13-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-1-methoxypropan-2-yl]-2,10,12,14-tetramethylhexadeca-2,4,6,8,10,14-hexaenamide (PubChem CID 25034370) has the molecular formula C30H51NO3Si and a molecular weight of 501.83 g/mol. Its IUPAC name is (2E,4E,6E,8E,10Z,12R,13R,14E)-13-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-1-methoxypropan-2-yl]-2,10,12,14-tetramethylhexadeca-2,4,6,8,10,14-hexaenamide.
| Compound Name | (2E,4E,6E,8E,10Z,12R,13R,14E)-13-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-1-methoxypropan-2-yl]-2,10,12,14-tetramethylhexadeca-2,4,6,8,10,14-hexaenamide |
|---|---|
| PubChem CID | 25034370 |
| Molecular Formula | C30H51NO3Si |
| Molecular Weight | 501.83 g/mol |
| Exact Mass | 501.36 |
| IUPAC Name | (2E,4E,6E,8E,10Z,12R,13R,14E)-13-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-1-methoxypropan-2-yl]-2,10,12,14-tetramethylhexadeca-2,4,6,8,10,14-hexaenamide |
| SMILES | C/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(C)\C=C\C=C\C=C\C=C(/C)C(=O)N[C@@H](C)COC |
| InChI | InChI=1S/C30H51NO3Si/c1-13-24(3)28(34-35(11,12)30(7,8)9)26(5)21-23(2)19-17-15-14-16-18-20-25(4)29(32)31-27(6)22-33-10/h13-21,26-28H,22H2,1-12H3,(H,31,32)/b15-14+,18-16+,19-17+,23-21-,24-13+,25-20+/t26-,27+,28+/m1/s1 |
| InChIKey | QBDZTVNHHSAVPW-ZPKQHZEHSA-N |
| XLogP | 7.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.83 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|