C20H40O3Si2 — CID 134982372
2-trimethylsilylethyl (2E,4E,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylhepta-2,4-dienoate (PubChem CID 134982372) has the molecular formula C20H40O3Si2 and a molecular weight of 384.71 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2E,4E,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylhepta-2,4-dienoate.
| Compound Name | 2-trimethylsilylethyl (2E,4E,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 134982372 |
| Molecular Formula | C20H40O3Si2 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-trimethylsilylethyl (2E,4E,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylhepta-2,4-dienoate |
| SMILES | CC(/C=C/C(=O)OCC[Si](C)(C)C)=C\[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O3Si2/c1-17(11-12-19(21)22-13-14-24(6,7)8)15-18(2)16-23-25(9,10)20(3,4)5/h11-12,15,18H,13-14,16H2,1-10H3/b12-11+,17-15+/t18-/m0/s1 |
| InChIKey | XLQSRDGKQUEBJB-JSRSQCJCSA-N |
| XLogP | 6.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|