C18H36O2Si — CID 11738487
(2R,4E,6E,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylnona-4,6-dien-1-ol (PubChem CID 11738487) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is (2R,4E,6E,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylnona-4,6-dien-1-ol.
| Compound Name | (2R,4E,6E,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylnona-4,6-dien-1-ol |
|---|---|
| PubChem CID | 11738487 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (2R,4E,6E,8R)-9-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethylnona-4,6-dien-1-ol |
| SMILES | CC(/C=C/C[C@@H](C)CO)=C\[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-15(10-9-11-16(2)13-19)12-17(3)14-20-21(7,8)18(4,5)6/h9-10,12,16-17,19H,11,13-14H2,1-8H3/b10-9+,15-12+/t16-,17-/m1/s1 |
| InChIKey | DIUQLJHKNIYBIY-ZABCLQKFSA-N |
| XLogP | 5.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|